C20H22N4O2 — CID 42591956
5-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-[[(2S)-oxan-2-yl]methyl]pyridin-2-amine (PubChem CID 42591956) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-[[(2S)-oxan-2-yl]methyl]pyridin-2-amine.
| Compound Name | 5-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-[[(2S)-oxan-2-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 42591956 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-(3-benzyl-1,2,4-oxadiazol-5-yl)-N-[[(2S)-oxan-2-yl]methyl]pyridin-2-amine |
| SMILES | c1ccc(Cc2noc(-c3ccc(NC[C@@H]4CCCCO4)nc3)n2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-6-15(7-3-1)12-19-23-20(26-24-19)16-9-10-18(21-13-16)22-14-17-8-4-5-11-25-17/h1-3,6-7,9-10,13,17H,4-5,8,11-12,14H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | BQDINDDPZMMQOO-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |