C22H22FNO2 — CID 42593289
1-[(3S)-3-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-3-phenylprop-2-yn-1-one (PubChem CID 42593289) has the molecular formula C22H22FNO2 and a molecular weight of 351.42 g/mol. Its IUPAC name is 1-[(3S)-3-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-3-phenylprop-2-yn-1-one.
| Compound Name | 1-[(3S)-3-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-3-phenylprop-2-yn-1-one |
|---|---|
| PubChem CID | 42593289 |
| Molecular Formula | C22H22FNO2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[(3S)-3-[(2-fluorophenyl)methyl]-3-(hydroxymethyl)piperidin-1-yl]-3-phenylprop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccccc1)N1CCC[C@](CO)(Cc2ccccc2F)C1 |
| InChI | InChI=1S/C22H22FNO2/c23-20-10-5-4-9-19(20)15-22(17-25)13-6-14-24(16-22)21(26)12-11-18-7-2-1-3-8-18/h1-5,7-10,25H,6,13-17H2/t22-/m0/s1 |
| InChIKey | XLQDYQMEQQFETG-QFIPXVFZSA-N |
| XLogP | 3.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|