C16H12N2O3 — CID 4259340
2,3-dihydronaphtho[3,2-f]quinoxaline-6,7,12-triol (PubChem CID 4259340) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,3-dihydronaphtho[3,2-f]quinoxaline-6,7,12-triol.
| Compound Name | 2,3-dihydronaphtho[3,2-f]quinoxaline-6,7,12-triol |
|---|---|
| PubChem CID | 4259340 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2,3-dihydronaphtho[3,2-f]quinoxaline-6,7,12-triol |
| SMILES | Oc1cc2c(c3c(O)c4ccccc4c(O)c13)=NCCN=2 |
| InChI | InChI=1S/C16H12N2O3/c19-11-7-10-14(18-6-5-17-10)13-12(11)15(20)8-3-1-2-4-9(8)16(13)21/h1-4,7,19-21H,5-6H2 |
| InChIKey | QERMMZDYAYIPNR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|