C23H32N4OS — CID 42594219
azocan-1-yl-[5-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone (PubChem CID 42594219) has the molecular formula C23H32N4OS and a molecular weight of 412.60 g/mol. Its IUPAC name is azocan-1-yl-[5-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone.
| Compound Name | azocan-1-yl-[5-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
|---|---|
| PubChem CID | 42594219 |
| Molecular Formula | C23H32N4OS |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | azocan-1-yl-[5-[[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethylamino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
| SMILES | O=C(c1nc2sccn2c1CNCC[C@@H]1C[C@@H]2C=C[C@H]1C2)N1CCCCCCC1 |
| InChI | InChI=1S/C23H32N4OS/c28-22(26-10-4-2-1-3-5-11-26)21-20(27-12-13-29-23(27)25-21)16-24-9-8-19-15-17-6-7-18(19)14-17/h6-7,12-13,17-19,24H,1-5,8-11,14-16H2/t17-,18+,19-/m1/s1 |
| InChIKey | PPRUUKUQYTWGKA-CEXWTWQISA-N |
| XLogP | 4.49 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|