C18H33N3O3S — CID 42595872
N-methyl-N-[[3-(3-methylbutyl)-2-propan-2-ylsulfonylimidazol-4-yl]methyl]oxan-4-amine (PubChem CID 42595872) has the molecular formula C18H33N3O3S and a molecular weight of 371.55 g/mol. Its IUPAC name is N-methyl-N-[[3-(3-methylbutyl)-2-propan-2-ylsulfonylimidazol-4-yl]methyl]oxan-4-amine.
| Compound Name | N-methyl-N-[[3-(3-methylbutyl)-2-propan-2-ylsulfonylimidazol-4-yl]methyl]oxan-4-amine |
|---|---|
| PubChem CID | 42595872 |
| Molecular Formula | C18H33N3O3S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-methyl-N-[[3-(3-methylbutyl)-2-propan-2-ylsulfonylimidazol-4-yl]methyl]oxan-4-amine |
| SMILES | CC(C)CCn1c(CN(C)C2CCOCC2)cnc1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C18H33N3O3S/c1-14(2)6-9-21-17(12-19-18(21)25(22,23)15(3)4)13-20(5)16-7-10-24-11-8-16/h12,14-16H,6-11,13H2,1-5H3 |
| InChIKey | FKMJBOFSGXULRD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |