C13H17ClN4PtS — CID 42597313
chloroplatinum(1+);(NE,1Z)-N-(pyridin-2-ylmethylidene)azepane-1-carbohydrazonothioate (PubChem CID 42597313) has the molecular formula C13H17ClN4PtS and a molecular weight of 491.91 g/mol. Its IUPAC name is chloroplatinum(1+);(NE,1Z)-N-(pyridin-2-ylmethylidene)azepane-1-carbohydrazonothioate.
| Compound Name | chloroplatinum(1+);(NE,1Z)-N-(pyridin-2-ylmethylidene)azepane-1-carbohydrazonothioate |
|---|---|
| PubChem CID | 42597313 |
| Molecular Formula | C13H17ClN4PtS |
| Molecular Weight | 491.91 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | chloroplatinum(1+);(NE,1Z)-N-(pyridin-2-ylmethylidene)azepane-1-carbohydrazonothioate |
| SMILES | Cl[Pt+].[S-]/C(=N\N=C\c1ccccn1)N1CCCCCC1 |
| InChI | InChI=1S/C13H18N4S.ClH.Pt/c18-13(17-9-5-1-2-6-10-17)16-15-11-12-7-3-4-8-14-12;;/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,16,18);1H;/q;;+2/p-2/b15-11+;; |
| InChIKey | GIZGRCWCRRIFDL-BXGYHSFXSA-L |
| XLogP | 2.88 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|