C13H19NO11S — CID 42597612
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfamoyloxane-2-carboxylate (PubChem CID 42597612) has the molecular formula C13H19NO11S and a molecular weight of 397.36 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfamoyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfamoyloxane-2-carboxylate |
|---|---|
| PubChem CID | 42597612 |
| Molecular Formula | C13H19NO11S |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-sulfamoyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](S(N)(=O)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H19NO11S/c1-5(15)22-8-9(23-6(2)16)11(24-7(3)17)13(26(14,19)20)25-10(8)12(18)21-4/h8-11,13H,1-4H3,(H2,14,19,20)/t8-,9-,10-,11+,13-/m0/s1 |
| InChIKey | CYLSCOJEVMRAAT-OBBGECFZSA-N |
| XLogP | -2.03 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|