C26H37NO19S — CID 42597615
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-sulfamoyloxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 42597615) has the molecular formula C26H37NO19S and a molecular weight of 699.64 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-sulfamoyloxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-sulfamoyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 42597615 |
| Molecular Formula | C26H37NO19S |
| Molecular Weight | 699.64 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-sulfamoyloxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](S(N)(=O)=O)O[C@@H]2COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H37NO19S/c1-10(28)37-8-17-19(39-12(3)30)21(40-13(4)31)23(42-15(6)33)25(44-17)46-20-18(9-38-11(2)29)45-26(47(27,35)36)24(43-16(7)34)22(20)41-14(5)32/h17-26H,8-9H2,1-7H3,(H2,27,35,36)/t17-,18-,19+,20-,21+,22+,23-,24-,25+,26+/m1/s1 |
| InChIKey | PRBMNHXZLHBQIF-NDMRNNIMSA-N |
| XLogP | -2.11 |
| TPSA | 271.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.64 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|