C26H33F3O7SSi — CID 42597619
[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethyl] trifluoromethanesulfonate (PubChem CID 42597619) has the molecular formula C26H33F3O7SSi and a molecular weight of 574.69 g/mol. Its IUPAC name is [(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethyl] trifluoromethanesulfonate.
| Compound Name | [(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 42597619 |
| Molecular Formula | C26H33F3O7SSi |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | [(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5R)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-1,3-dioxolan-4-yl]ethyl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]([C@@H]2CO2)[C@@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C26H33F3O7SSi/c1-24(2,3)38(18-12-8-6-9-13-18,19-14-10-7-11-15-19)33-17-21(36-37(30,31)26(27,28)29)23-22(20-16-32-20)34-25(4,5)35-23/h6-15,20-23H,16-17H2,1-5H3/t20-,21+,22+,23+/m0/s1 |
| InChIKey | KPDNYCCDNLPCMI-WBADGQHESA-N |
| XLogP | 3.72 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|