About [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol
[2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol (PubChem CID 42597685) has the molecular formula C21H21NO3
and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol |
| PubChem CID | 42597685 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol |
| SMILES | COc1ccccc1-c1c(CO)c(CO)c2n1Cc1ccccc1C2 |
| InChI | InChI=1S/C21H21NO3/c1-25-20-9-5-4-8-16(20)21-18(13-24)17(12-23)19-10-14-6-2-3-7-15(14)11-22(19)21/h2-9,23-24H,10-13H2,1H3 |
| InChIKey | PXUSRMJINWBAMN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol?
The IUPAC name of [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol (CID 42597685) is [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol.
What is the SMILES notation for [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol?
The canonical SMILES for [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol is COc1ccccc1-c1c(CO)c(CO)c2n1Cc1ccccc1C2.
What is the InChIKey of [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol?
The InChIKey is PXUSRMJINWBAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3/c1-25-20-9-5-4-8-16(20)21-18(13-24)17(12-23)19-10-14-6-2-3-7-15(14)11-22(19)21/h2-9,23-24H,10-13H2,1H3.
What are the key properties of [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol?
[2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol has a molecular weight of 335.40 g/mol, XLogP of 3.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3-(2-methoxyphenyl)-5,10-dihydropyrrolo[1,2-b]isoquinolin-1-yl]methanol is sourced from PubChem (CID 42597685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).