C22H38O2Si — CID 42597979
(4aR,5S,6R,8aR)-5,8a-dimethyl-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde (PubChem CID 42597979) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (4aR,5S,6R,8aR)-5,8a-dimethyl-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde.
| Compound Name | (4aR,5S,6R,8aR)-5,8a-dimethyl-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 42597979 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (4aR,5S,6R,8aR)-5,8a-dimethyl-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydronaphthalene-2-carbaldehyde |
| SMILES | C=CC[C@]1(C)[C@H](O[Si](CC)(CC)CC)CC[C@]2(C)C=C(C=O)CC[C@@H]12 |
| InChI | InChI=1S/C22H38O2Si/c1-7-14-22(6)19-12-11-18(17-23)16-21(19,5)15-13-20(22)24-25(8-2,9-3)10-4/h7,16-17,19-20H,1,8-15H2,2-6H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | UKRRLJGIBHYFBO-YSFYHYPLSA-N |
| XLogP | 6.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|