C23H40O2Si — CID 42597983
(1R,4aR,5S,6R,8aS)-5,8a-dimethyl-2-methylidene-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde (PubChem CID 42597983) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (1R,4aR,5S,6R,8aS)-5,8a-dimethyl-2-methylidene-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde.
| Compound Name | (1R,4aR,5S,6R,8aS)-5,8a-dimethyl-2-methylidene-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 42597983 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (1R,4aR,5S,6R,8aS)-5,8a-dimethyl-2-methylidene-5-prop-2-enyl-6-triethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde |
| SMILES | C=CC[C@@]1(C)[C@@H]2CCC(=C)[C@@H](C=O)[C@@]2(C)CC[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H40O2Si/c1-8-15-23(7)20-13-12-18(5)19(17-24)22(20,6)16-14-21(23)25-26(9-2,10-3)11-4/h8,17,19-21H,1,5,9-16H2,2-4,6-7H3/t19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | RGTYOAHQONICMS-JLMDMGSGSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|