About (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine
(E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine (PubChem CID 42598388) has the molecular formula C23H23N3O2
and a molecular weight of 373.46 g/mol. Its IUPAC name is (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine.
Molecular Properties
| Compound Name | (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine |
| PubChem CID | 42598388 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine |
| SMILES | COc1ccc2c(c1)/C(=N\OCCN1CCCC1)c1c-2cnc2ccccc12 |
| InChI | InChI=1S/C23H23N3O2/c1-27-16-8-9-17-19(14-16)23(25-28-13-12-26-10-4-5-11-26)22-18-6-2-3-7-21(18)24-15-20(17)22/h2-3,6-9,14-15H,4-5,10-13H2,1H3/b25-23+ |
| InChIKey | HYOJEDQSYXZDSS-WJTDDFOZSA-N |
| XLogP | 4.09 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine?
The IUPAC name of (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine (CID 42598388) is (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine.
What is the SMILES notation for (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine?
The canonical SMILES for (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine is COc1ccc2c(c1)/C(=N\OCCN1CCCC1)c1c-2cnc2ccccc12.
What is the InChIKey of (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine?
The InChIKey is HYOJEDQSYXZDSS-WJTDDFOZSA-N. The full InChI is InChI=1S/C23H23N3O2/c1-27-16-8-9-17-19(14-16)23(25-28-13-12-26-10-4-5-11-26)22-18-6-2-3-7-21(18)24-15-20(17)22/h2-3,6-9,14-15H,4-5,10-13H2,1H3/b25-23+.
What are the key properties of (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine?
(E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine has a molecular weight of 373.46 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-9-methoxy-N-(2-pyrrolidin-1-ylethoxy)indeno[1,2-c]quinolin-11-imine is sourced from PubChem (CID 42598388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).