C20H29NO4 — CID 42598639
2-[4-(azepan-1-yl)-3-hydroxy-3-methyl-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 42598639) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[4-(azepan-1-yl)-3-hydroxy-3-methyl-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-(azepan-1-yl)-3-hydroxy-3-methyl-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 42598639 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[4-(azepan-1-yl)-3-hydroxy-3-methyl-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCC(C)(O)C(=O)N2CCCCCC2)=C(C)C1=O |
| InChI | InChI=1S/C20H29NO4/c1-13-14(2)18(23)16(15(3)17(13)22)9-10-20(4,25)19(24)21-11-7-5-6-8-12-21/h25H,5-12H2,1-4H3 |
| InChIKey | IBQDEFFOOZANGJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|