About CID 42598694
CID 42598694 (PubChem CID 42598694) has the molecular formula C30H24N2O3
and a molecular weight of 460.53 g/mol.
Molecular Properties
| Compound Name | CID 42598694 |
| PubChem CID | 42598694 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@]2(CCc3c([nH]c4ccccc34)C2=O)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H24N2O3/c1-32-17-23(18-9-3-2-4-10-18)29(30(32)26(33)21-12-5-6-13-22(21)27(30)34)16-15-20-19-11-7-8-14-24(19)31-25(20)28(29)35/h2-14,23,31H,15-17H2,1H3/t23-,29+/m0/s1 |
| InChIKey | MZPKBOKEPDOODL-MUAVYFROSA-N |
| XLogP | 4.83 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 42598694 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 42598694?
The IUPAC name of CID 42598694 (CID 42598694) is not available.
What is the SMILES notation for CID 42598694?
The canonical SMILES for CID 42598694 is CN1C[C@@H](c2ccccc2)[C@@]2(CCc3c([nH]c4ccccc34)C2=O)C12C(=O)c1ccccc1C2=O.
What is the InChIKey of CID 42598694?
The InChIKey is MZPKBOKEPDOODL-MUAVYFROSA-N. The full InChI is InChI=1S/C30H24N2O3/c1-32-17-23(18-9-3-2-4-10-18)29(30(32)26(33)21-12-5-6-13-22(21)27(30)34)16-15-20-19-11-7-8-14-24(19)31-25(20)28(29)35/h2-14,23,31H,15-17H2,1H3/t23-,29+/m0/s1.
What are the key properties of CID 42598694?
CID 42598694 has a molecular weight of 460.53 g/mol, XLogP of 4.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 42598694 is sourced from PubChem (CID 42598694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).