About CID 42598695
CID 42598695 (PubChem CID 42598695) has the molecular formula C31H26N2O3
and a molecular weight of 474.56 g/mol.
Molecular Properties
| Compound Name | CID 42598695 |
| PubChem CID | 42598695 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | — |
| SMILES | Cc1ccc([C@@H]2CN(C)C3(C(=O)c4ccccc4C3=O)[C@]23CCc2c([nH]c4ccccc24)C3=O)cc1 |
| InChI | InChI=1S/C31H26N2O3/c1-18-11-13-19(14-12-18)24-17-33(2)31(27(34)22-8-3-4-9-23(22)28(31)35)30(24)16-15-21-20-7-5-6-10-25(20)32-26(21)29(30)36/h3-14,24,32H,15-17H2,1-2H3/t24-,30+/m0/s1 |
| InChIKey | XPRDZZIARXGMBZ-QABMSTFYSA-N |
| XLogP | 5.14 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 42598695 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 42598695?
The IUPAC name of CID 42598695 (CID 42598695) is not available.
What is the SMILES notation for CID 42598695?
The canonical SMILES for CID 42598695 is Cc1ccc([C@@H]2CN(C)C3(C(=O)c4ccccc4C3=O)[C@]23CCc2c([nH]c4ccccc24)C3=O)cc1.
What is the InChIKey of CID 42598695?
The InChIKey is XPRDZZIARXGMBZ-QABMSTFYSA-N. The full InChI is InChI=1S/C31H26N2O3/c1-18-11-13-19(14-12-18)24-17-33(2)31(27(34)22-8-3-4-9-23(22)28(31)35)30(24)16-15-21-20-7-5-6-10-25(20)32-26(21)29(30)36/h3-14,24,32H,15-17H2,1-2H3/t24-,30+/m0/s1.
What are the key properties of CID 42598695?
CID 42598695 has a molecular weight of 474.56 g/mol, XLogP of 5.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 42598695 is sourced from PubChem (CID 42598695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).