About CID 42598936
CID 42598936 (PubChem CID 42598936) has the molecular formula C34H28N2O2
and a molecular weight of 496.61 g/mol.
Molecular Properties
| Compound Name | CID 42598936 |
| PubChem CID | 42598936 |
| Molecular Formula | C34H28N2O2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | — |
| SMILES | Cc1ccc([C@@H]2CN(C)[C@@]3(C(=O)c4cccc5cccc3c45)[C@]23CCc2c([nH]c4ccccc24)C3=O)cc1 |
| InChI | InChI=1S/C34H28N2O2/c1-20-13-15-21(16-14-20)27-19-36(2)34(26-11-6-8-22-7-5-10-25(29(22)26)31(34)37)33(27)18-17-24-23-9-3-4-12-28(23)35-30(24)32(33)38/h3-16,27,35H,17-19H2,1-2H3/t27-,33+,34-/m0/s1 |
| InChIKey | IXOLNTUAIKCPRR-BIWWMPFASA-N |
| XLogP | 6.57 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze CID 42598936 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 42598936?
The IUPAC name of CID 42598936 (CID 42598936) is not available.
What is the SMILES notation for CID 42598936?
The canonical SMILES for CID 42598936 is Cc1ccc([C@@H]2CN(C)[C@@]3(C(=O)c4cccc5cccc3c45)[C@]23CCc2c([nH]c4ccccc24)C3=O)cc1.
What is the InChIKey of CID 42598936?
The InChIKey is IXOLNTUAIKCPRR-BIWWMPFASA-N. The full InChI is InChI=1S/C34H28N2O2/c1-20-13-15-21(16-14-20)27-19-36(2)34(26-11-6-8-22-7-5-10-25(29(22)26)31(34)37)33(27)18-17-24-23-9-3-4-12-28(23)35-30(24)32(33)38/h3-16,27,35H,17-19H2,1-2H3/t27-,33+,34-/m0/s1.
What are the key properties of CID 42598936?
CID 42598936 has a molecular weight of 496.61 g/mol, XLogP of 6.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 42598936 is sourced from PubChem (CID 42598936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).