About 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol
4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol (PubChem CID 42598980) has the molecular formula C11H10F3N3O4
and a molecular weight of 305.21 g/mol. Its IUPAC name is 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol.
Molecular Properties
| Compound Name | 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol |
| PubChem CID | 42598980 |
| Molecular Formula | C11H10F3N3O4 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol |
| SMILES | COC1=Nc2ccc([N+](=O)[O-])cc2NC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H10F3N3O4/c1-21-9-5-10(18,11(12,13)14)16-8-4-6(17(19)20)2-3-7(8)15-9/h2-4,16,18H,5H2,1H3 |
| InChIKey | LSWJOFGQFVDSRL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol?
The IUPAC name of 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol (CID 42598980) is 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol.
What is the SMILES notation for 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol?
The canonical SMILES for 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol is COC1=Nc2ccc([N+](=O)[O-])cc2NC(O)(C(F)(F)F)C1.
What is the InChIKey of 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol?
The InChIKey is LSWJOFGQFVDSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3O4/c1-21-9-5-10(18,11(12,13)14)16-8-4-6(17(19)20)2-3-7(8)15-9/h2-4,16,18H,5H2,1H3.
What are the key properties of 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol?
4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol has a molecular weight of 305.21 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-8-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol is sourced from PubChem (CID 42598980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).