C23H24N2O5S — CID 4259927
N-(2,5-dimethylphenyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide (PubChem CID 4259927) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4259927 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OCC(=O)Nc3cc(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-16-4-5-17(2)22(14-16)24-23(26)15-30-20-10-12-21(13-11-20)31(27,28)25-18-6-8-19(29-3)9-7-18/h4-14,25H,15H2,1-3H3,(H,24,26) |
| InChIKey | RNEGOFGWQQMAAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |