C17H23N3O3 — CID 42599307
(5aR,9bS)-3a-hydroxy-5a,9-dimethyl-3-(1,2,4-triazol-1-ylmethyl)-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 42599307) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (5aR,9bS)-3a-hydroxy-5a,9-dimethyl-3-(1,2,4-triazol-1-ylmethyl)-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (5aR,9bS)-3a-hydroxy-5a,9-dimethyl-3-(1,2,4-triazol-1-ylmethyl)-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 42599307 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (5aR,9bS)-3a-hydroxy-5a,9-dimethyl-3-(1,2,4-triazol-1-ylmethyl)-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | CC1=C2[C@@H]3OC(=O)C(Cn4cncn4)C3(O)CC[C@@]2(C)CCC1 |
| InChI | InChI=1S/C17H23N3O3/c1-11-4-3-5-16(2)6-7-17(22)12(8-20-10-18-9-19-20)15(21)23-14(17)13(11)16/h9-10,12,14,22H,3-8H2,1-2H3/t12?,14-,16+,17?/m0/s1 |
| InChIKey | YGNRZGOHCJFDQS-ORTQGIPQSA-N |
| XLogP | 1.85 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|