C10H14O5 — CID 42599432
(3R,3aR,5R,5'S,6aR)-3-hydroxy-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one (PubChem CID 42599432) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (3R,3aR,5R,5'S,6aR)-3-hydroxy-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one.
| Compound Name | (3R,3aR,5R,5'S,6aR)-3-hydroxy-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 42599432 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (3R,3aR,5R,5'S,6aR)-3-hydroxy-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
| SMILES | C[C@H]1CC[C@@]2(C[C@H]3OC(=O)[C@H](O)[C@H]3O2)O1 |
| InChI | InChI=1S/C10H14O5/c1-5-2-3-10(14-5)4-6-8(15-10)7(11)9(12)13-6/h5-8,11H,2-4H2,1H3/t5-,6+,7+,8-,10+/m0/s1 |
| InChIKey | MUCCMLIKJRUYPD-IWYOCHMKSA-N |
| XLogP | -0.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |