C18H32O4 — CID 42600159
[(2S,3S)-3-methyl-3-[(E)-4-methyl-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]hex-3-enyl]oxiran-2-yl]methanol (PubChem CID 42600159) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-3-[(E)-4-methyl-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]hex-3-enyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-methyl-3-[(E)-4-methyl-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]hex-3-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 42600159 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [(2S,3S)-3-methyl-3-[(E)-4-methyl-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]hex-3-enyl]oxiran-2-yl]methanol |
| SMILES | C/C(=C\CC[C@]1(C)O[C@H]1CO)CC[C@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C18H32O4/c1-13(8-7-11-18(6)15(12-19)21-18)9-10-14-16(2,3)22-17(4,5)20-14/h8,14-15,19H,7,9-12H2,1-6H3/b13-8+/t14-,15+,18+/m1/s1 |
| InChIKey | VBQAIBWKPFDOJG-IJPAAPAMSA-N |
| XLogP | 3.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|