C21H40O5Si — CID 42600165
ethyl (Z)-4-[(4R,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 42600165) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is ethyl (Z)-4-[(4R,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | ethyl (Z)-4-[(4R,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 42600165 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | ethyl (Z)-4-[(4R,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C\C[C@@H]1C[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C21H40O5Si/c1-10-23-19(22)13-11-12-17-15-18(25-21(6,7)24-17)14-16(2)26-27(8,9)20(3,4)5/h11,13,16-18H,10,12,14-15H2,1-9H3/b13-11-/t16-,17+,18-/m0/s1 |
| InChIKey | WPURPBGEXWVNCP-LBYKVGFZSA-N |
| XLogP | 5.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|