About [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate
[2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate (PubChem CID 42600363) has the molecular formula C23H23N3O4
and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate.
Molecular Properties
| Compound Name | [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate |
| PubChem CID | 42600363 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1c(COC(=O)NC)c(-c2ccccc2)n2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C23H23N3O4/c1-24-22(27)29-13-17-18(14-30-23(28)25-2)21(15-8-4-3-5-9-15)26-19-11-7-6-10-16(19)12-20(17)26/h3-11H,12-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | SNVABUQWFGBSKP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate?
The IUPAC name of [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate (CID 42600363) is [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate.
What is the SMILES notation for [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate?
The canonical SMILES for [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate is CNC(=O)OCc1c(COC(=O)NC)c(-c2ccccc2)n2c1Cc1ccccc1-2.
What is the InChIKey of [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate?
The InChIKey is SNVABUQWFGBSKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O4/c1-24-22(27)29-13-17-18(14-30-23(28)25-2)21(15-8-4-3-5-9-15)26-19-11-7-6-10-16(19)12-20(17)26/h3-11H,12-14H2,1-2H3,(H,24,27)(H,25,28).
What are the key properties of [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate?
[2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate has a molecular weight of 405.45 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylcarbamoyloxymethyl)-1-phenyl-4H-pyrrolo[1,2-a]indol-3-yl]methyl N-methylcarbamate is sourced from PubChem (CID 42600363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).