C16H26O3 — CID 42600406
(2R,3R)-2-[2-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-ethenyl-2-methyloxirane (PubChem CID 42600406) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2R,3R)-2-[2-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-ethenyl-2-methyloxirane.
| Compound Name | (2R,3R)-2-[2-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-ethenyl-2-methyloxirane |
|---|---|
| PubChem CID | 42600406 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (2R,3R)-2-[2-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]ethyl]-3-ethenyl-2-methyloxirane |
| SMILES | C=C[C@H]1O[C@]1(C)CC[C@H]1O[C@]1(C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C16H26O3/c1-6-11-15(4,18-11)10-8-13-16(5,19-13)9-7-12-14(2,3)17-12/h6,11-13H,1,7-10H2,2-5H3/t11-,12-,13-,15-,16-/m1/s1 |
| InChIKey | IQQQDLJJZWGHJV-GLKFPVFTSA-N |
| XLogP | 3.23 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|