C27H48O4Si — CID 42600417
tert-butyl (2R,3R,4S)-2,4-dimethyl-5-phenylmethoxy-3-tri(propan-2-yl)silyloxypentanoate (PubChem CID 42600417) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S)-2,4-dimethyl-5-phenylmethoxy-3-tri(propan-2-yl)silyloxypentanoate.
| Compound Name | tert-butyl (2R,3R,4S)-2,4-dimethyl-5-phenylmethoxy-3-tri(propan-2-yl)silyloxypentanoate |
|---|---|
| PubChem CID | 42600417 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | tert-butyl (2R,3R,4S)-2,4-dimethyl-5-phenylmethoxy-3-tri(propan-2-yl)silyloxypentanoate |
| SMILES | CC(C)[Si](O[C@H]([C@@H](C)COCc1ccccc1)[C@@H](C)C(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H48O4Si/c1-19(2)32(20(3)4,21(5)6)31-25(23(8)26(28)30-27(9,10)11)22(7)17-29-18-24-15-13-12-14-16-24/h12-16,19-23,25H,17-18H2,1-11H3/t22-,23+,25+/m0/s1 |
| InChIKey | XKWLWSHWKGNCIQ-JBRSBNLGSA-N |
| XLogP | 7.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|