About 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide
2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 42600450) has the molecular formula C6H8N4O3
and a molecular weight of 184.16 g/mol. Its IUPAC name is 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| PubChem CID | 42600450 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | NCC(=O)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H8N4O3/c7-1-4(11)9-3-2-8-6(13)10-5(3)12/h2H,1,7H2,(H,9,11)(H2,8,10,12,13) |
| InChIKey | CYZVIXVPBGIRLD-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
The IUPAC name of 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide (CID 42600450) is 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
What is the SMILES notation for 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
The canonical SMILES for 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide is NCC(=O)Nc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
The InChIKey is CYZVIXVPBGIRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3/c7-1-4(11)9-3-2-8-6(13)10-5(3)12/h2H,1,7H2,(H,9,11)(H2,8,10,12,13).
What are the key properties of 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide?
2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide has a molecular weight of 184.16 g/mol, XLogP of -2.04, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide is sourced from PubChem (CID 42600450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).