About 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one
2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one (PubChem CID 42600648) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one |
| PubChem CID | 42600648 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one |
| SMILES | COc1ccc2c(c1)C(=O)N(c1ccc3c(c1)cc(C)n3C)C2 |
| InChI | InChI=1S/C19H18N2O2/c1-12-8-14-9-15(5-7-18(14)20(12)2)21-11-13-4-6-16(23-3)10-17(13)19(21)22/h4-10H,11H2,1-3H3 |
| InChIKey | HSTSQRFMVXPMKV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one?
The IUPAC name of 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one (CID 42600648) is 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one.
What is the SMILES notation for 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one?
The canonical SMILES for 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one is COc1ccc2c(c1)C(=O)N(c1ccc3c(c1)cc(C)n3C)C2.
What is the InChIKey of 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one?
The InChIKey is HSTSQRFMVXPMKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-12-8-14-9-15(5-7-18(14)20(12)2)21-11-13-4-6-16(23-3)10-17(13)19(21)22/h4-10H,11H2,1-3H3.
What are the key properties of 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one?
2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one has a molecular weight of 306.37 g/mol, XLogP of 3.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethylindol-5-yl)-6-methoxy-3H-isoindol-1-one is sourced from PubChem (CID 42600648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).