C21H40Br2O3Si — CID 42600668
tert-butyl (2R,3R,4S)-6,6-dibromo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enoate (PubChem CID 42600668) has the molecular formula C21H40Br2O3Si and a molecular weight of 528.44 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S)-6,6-dibromo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enoate.
| Compound Name | tert-butyl (2R,3R,4S)-6,6-dibromo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enoate |
|---|---|
| PubChem CID | 42600668 |
| Molecular Formula | C21H40Br2O3Si |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | tert-butyl (2R,3R,4S)-6,6-dibromo-2,4-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enoate |
| SMILES | CC(C)[Si](O[C@H]([C@@H](C)C=C(Br)Br)[C@@H](C)C(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H40Br2O3Si/c1-13(2)27(14(3)4,15(5)6)26-19(16(7)12-18(22)23)17(8)20(24)25-21(9,10)11/h12-17,19H,1-11H3/t16-,17+,19+/m0/s1 |
| InChIKey | ZNLQXFMNNDKPIS-YQVWRLOYSA-N |
| XLogP | 7.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|