C16H23IO6 — CID 42600836
methyl 2-ethoxy-2-[(2S,4R,6R)-4-iodo-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]acetate (PubChem CID 42600836) has the molecular formula C16H23IO6 and a molecular weight of 438.26 g/mol. Its IUPAC name is methyl 2-ethoxy-2-[(2S,4R,6R)-4-iodo-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]acetate.
| Compound Name | methyl 2-ethoxy-2-[(2S,4R,6R)-4-iodo-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]acetate |
|---|---|
| PubChem CID | 42600836 |
| Molecular Formula | C16H23IO6 |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | methyl 2-ethoxy-2-[(2S,4R,6R)-4-iodo-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]acetate |
| SMILES | CCOC(C(=O)OC)[C@@]1(C)C(=O)[C@H](I)C(=O)[C@H](C)C2CCC1O2 |
| InChI | InChI=1S/C16H23IO6/c1-5-22-14(15(20)21-4)16(3)10-7-6-9(23-10)8(2)12(18)11(17)13(16)19/h8-11,14H,5-7H2,1-4H3/t8-,9?,10?,11-,14?,16-/m1/s1 |
| InChIKey | NGCWUSJUOBZCCF-XTTRUSAISA-N |
| XLogP | 1.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|