C31H32N2O6 — CID 42600993
methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-[3-methoxy-4-(4-methoxyphenyl)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 42600993) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-[3-methoxy-4-(4-methoxyphenyl)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-[3-methoxy-4-(4-methoxyphenyl)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 42600993 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-3-benzyl-5-ethyl-1-[3-methoxy-4-(4-methoxyphenyl)phenyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4ccc(OC)cc4)c(OC)c3)N[C@@](Cc3ccccc3)(C(=O)OC)[C@H]2C1=O |
| InChI | InChI=1S/C31H32N2O6/c1-5-33-28(34)25-26(29(33)35)31(30(36)39-4,18-19-9-7-6-8-10-19)32-27(25)21-13-16-23(24(17-21)38-3)20-11-14-22(37-2)15-12-20/h6-17,25-27,32H,5,18H2,1-4H3/t25-,26-,27-,31-/m1/s1 |
| InChIKey | XJFDAXUAIYENPO-ACXCVDCASA-N |
| XLogP | 3.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|