C25H25FN2O4 — CID 42601052
methyl (3aS,4S,9aS,9bR)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate (PubChem CID 42601052) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is methyl (3aS,4S,9aS,9bR)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate.
| Compound Name | methyl (3aS,4S,9aS,9bR)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
|---|---|
| PubChem CID | 42601052 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | methyl (3aS,4S,9aS,9bR)-4-[4-(4-fluorophenyl)phenyl]-2-methyl-1,3-dioxo-4,6,7,8,9,9b-hexahydro-3aH-pyrrolo[3,4-a]indolizine-9a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCCN1[C@H](c1ccc(-c3ccc(F)cc3)cc1)[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C25H25FN2O4/c1-27-22(29)19-20(23(27)30)25(24(31)32-2)13-3-4-14-28(25)21(19)17-7-5-15(6-8-17)16-9-11-18(26)12-10-16/h5-12,19-21H,3-4,13-14H2,1-2H3/t19-,20-,21+,25-/m0/s1 |
| InChIKey | FVCCLOICVKDTNY-HULNYRCFSA-N |
| XLogP | 3.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|