C29H28N2O5S — CID 42601063
methyl (1S,3R,3aS,6aR)-1-[4-(4-acetylthiophen-2-yl)phenyl]-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 42601063) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-1-[4-(4-acetylthiophen-2-yl)phenyl]-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-1-[4-(4-acetylthiophen-2-yl)phenyl]-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 42601063 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-1-[4-(4-acetylthiophen-2-yl)phenyl]-3-benzyl-5-ethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(-c4cc(C(C)=O)cs4)cc3)N[C@@](Cc3ccccc3)(C(=O)OC)[C@H]2C1=O |
| InChI | InChI=1S/C29H28N2O5S/c1-4-31-26(33)23-24(27(31)34)29(28(35)36-3,15-18-8-6-5-7-9-18)30-25(23)20-12-10-19(11-13-20)22-14-21(16-37-22)17(2)32/h5-14,16,23-25,30H,4,15H2,1-3H3/t23-,24-,25-,29-/m1/s1 |
| InChIKey | IHRYNJIRWOZTHZ-DOUCHOMGSA-N |
| XLogP | 4.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|