C27H24N2O3 — CID 42601165
(2R,11R,12R,13R)-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16(21),17,19-hexaene-14,22-dione (PubChem CID 42601165) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is (2R,11R,12R,13R)-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16(21),17,19-hexaene-14,22-dione.
| Compound Name | (2R,11R,12R,13R)-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16(21),17,19-hexaene-14,22-dione |
|---|---|
| PubChem CID | 42601165 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2R,11R,12R,13R)-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3,5,7,16(21),17,19-hexaene-14,22-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N1[C@H]3c4ccccc4OC[C@@H]3[C@H](c3ccccc3)[C@]1(C)C(=O)N2 |
| InChI | InChI=1S/C27H24N2O3/c1-16-12-13-21-19(14-16)25(30)29-24-18-10-6-7-11-22(18)32-15-20(24)23(17-8-4-3-5-9-17)27(29,2)26(31)28-21/h3-14,20,23-24H,15H2,1-2H3,(H,28,31)/t20-,23+,24+,27-/m1/s1 |
| InChIKey | ODRREPMETVOWCG-MBPYSEENSA-N |
| XLogP | 4.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |