C27H23ClN2O3 — CID 42601192
(2R,11R,12R,13R)-5-chloro-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16(21),17,19-hexaene-14,22-dione (PubChem CID 42601192) has the molecular formula C27H23ClN2O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is (2R,11R,12R,13R)-5-chloro-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16(21),17,19-hexaene-14,22-dione.
| Compound Name | (2R,11R,12R,13R)-5-chloro-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16(21),17,19-hexaene-14,22-dione |
|---|---|
| PubChem CID | 42601192 |
| Molecular Formula | C27H23ClN2O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2R,11R,12R,13R)-5-chloro-13,19-dimethyl-12-phenyl-9-oxa-1,15-diazapentacyclo[11.9.0.02,11.03,8.016,21]docosa-3(8),4,6,16(21),17,19-hexaene-14,22-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N1[C@H]3c4cc(Cl)ccc4OC[C@@H]3[C@H](c3ccccc3)[C@]1(C)C(=O)N2 |
| InChI | InChI=1S/C27H23ClN2O3/c1-15-8-10-21-18(12-15)25(31)30-24-19-13-17(28)9-11-22(19)33-14-20(24)23(16-6-4-3-5-7-16)27(30,2)26(32)29-21/h3-13,20,23-24H,14H2,1-2H3,(H,29,32)/t20-,23+,24+,27-/m1/s1 |
| InChIKey | YLQACJMKMATMEU-MBPYSEENSA-N |
| XLogP | 5.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |