C26H23N5O5 — CID 42601200
N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide (PubChem CID 42601200) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 42601200 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccccc1-c1cc(C(=O)NCc2ccco2)nn1CC1CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C26H23N5O5/c1-17-6-2-3-10-22(17)25-14-24(26(32)27-15-20-9-5-11-35-20)28-30(25)16-21-13-23(29-36-21)18-7-4-8-19(12-18)31(33)34/h2-12,14,21H,13,15-16H2,1H3,(H,27,32) |
| InChIKey | PYUVAVVCXGUAEE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|