About (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate
(2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate (PubChem CID 42601243) has the molecular formula C26H34O2
and a molecular weight of 378.56 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate.
Molecular Properties
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate |
| PubChem CID | 42601243 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate |
| SMILES | C=CCC(C(=O)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H34O2/c1-9-13-20(19-14-11-10-12-15-19)24(27)28-23-21(25(3,4)5)16-18(2)17-22(23)26(6,7)8/h9-12,14-17,20H,1,13H2,2-8H3 |
| InChIKey | SAEJPSXEKKDITN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate?
The IUPAC name of (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate (CID 42601243) is (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate.
What is the SMILES notation for (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate?
The canonical SMILES for (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate is C=CCC(C(=O)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C)c1ccccc1.
What is the InChIKey of (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate?
The InChIKey is SAEJPSXEKKDITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34O2/c1-9-13-20(19-14-11-10-12-15-19)24(27)28-23-21(25(3,4)5)16-18(2)17-22(23)26(6,7)8/h9-12,14-17,20H,1,13H2,2-8H3.
What are the key properties of (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate?
(2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate has a molecular weight of 378.56 g/mol, XLogP of 6.86, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-ditert-butyl-4-methylphenyl) 2-phenylpent-4-enoate is sourced from PubChem (CID 42601243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).