About [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate
[2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate (PubChem CID 42601244) has the molecular formula C22H28O2
and a molecular weight of 324.46 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate.
Molecular Properties
| Compound Name | [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate |
| PubChem CID | 42601244 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)Oc1c(C(C)C)cccc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H28O2/c1-6-18(17-11-8-7-9-12-17)22(23)24-21-19(15(2)3)13-10-14-20(21)16(4)5/h7-16,18H,6H2,1-5H3 |
| InChIKey | JCLGYSMGGJGGJT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate?
The IUPAC name of [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate (CID 42601244) is [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate.
What is the SMILES notation for [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate?
The canonical SMILES for [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate is CCC(C(=O)Oc1c(C(C)C)cccc1C(C)C)c1ccccc1.
What is the InChIKey of [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate?
The InChIKey is JCLGYSMGGJGGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O2/c1-6-18(17-11-8-7-9-12-17)22(23)24-21-19(15(2)3)13-10-14-20(21)16(4)5/h7-16,18H,6H2,1-5H3.
What are the key properties of [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate?
[2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate has a molecular weight of 324.46 g/mol, XLogP of 6.03, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-di(propan-2-yl)phenyl] 2-phenylbutanoate is sourced from PubChem (CID 42601244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).