About S-benzyl 2-(4-chlorophenyl)ethanethioate
S-benzyl 2-(4-chlorophenyl)ethanethioate (PubChem CID 42601250) has the molecular formula C15H13ClOS
and a molecular weight of 276.79 g/mol. Its IUPAC name is S-benzyl 2-(4-chlorophenyl)ethanethioate.
Molecular Properties
| Compound Name | S-benzyl 2-(4-chlorophenyl)ethanethioate |
| PubChem CID | 42601250 |
| Molecular Formula | C15H13ClOS |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | S-benzyl 2-(4-chlorophenyl)ethanethioate |
| SMILES | O=C(Cc1ccc(Cl)cc1)SCc1ccccc1 |
| InChI | InChI=1S/C15H13ClOS/c16-14-8-6-12(7-9-14)10-15(17)18-11-13-4-2-1-3-5-13/h1-9H,10-11H2 |
| InChIKey | UTNXTRJJCIJMJG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzyl 2-(4-chlorophenyl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzyl 2-(4-chlorophenyl)ethanethioate?
The IUPAC name of S-benzyl 2-(4-chlorophenyl)ethanethioate (CID 42601250) is S-benzyl 2-(4-chlorophenyl)ethanethioate.
What is the SMILES notation for S-benzyl 2-(4-chlorophenyl)ethanethioate?
The canonical SMILES for S-benzyl 2-(4-chlorophenyl)ethanethioate is O=C(Cc1ccc(Cl)cc1)SCc1ccccc1.
What is the InChIKey of S-benzyl 2-(4-chlorophenyl)ethanethioate?
The InChIKey is UTNXTRJJCIJMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClOS/c16-14-8-6-12(7-9-14)10-15(17)18-11-13-4-2-1-3-5-13/h1-9H,10-11H2.
What are the key properties of S-benzyl 2-(4-chlorophenyl)ethanethioate?
S-benzyl 2-(4-chlorophenyl)ethanethioate has a molecular weight of 276.79 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzyl 2-(4-chlorophenyl)ethanethioate is sourced from PubChem (CID 42601250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).