About 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid
1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid (PubChem CID 42601310) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid |
| PubChem CID | 42601310 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(Cn2nc(-c3ccccc3C)cc2C(=O)O)on1 |
| InChI | InChI=1S/C16H15N3O3/c1-10-5-3-4-6-13(10)14-8-15(16(20)21)19(17-14)9-12-7-11(2)18-22-12/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | LRNIDPLMJZGMRJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid?
The IUPAC name of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid (CID 42601310) is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid.
What is the SMILES notation for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid?
The canonical SMILES for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid is Cc1cc(Cn2nc(-c3ccccc3C)cc2C(=O)O)on1.
What is the InChIKey of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid?
The InChIKey is LRNIDPLMJZGMRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-10-5-3-4-6-13(10)14-8-15(16(20)21)19(17-14)9-12-7-11(2)18-22-12/h3-8H,9H2,1-2H3,(H,20,21).
What are the key properties of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid?
1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid has a molecular weight of 297.31 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-(2-methylphenyl)pyrazole-5-carboxylic acid is sourced from PubChem (CID 42601310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).