C28H39NO3 — CID 42601335
(1R,5R,9S,13S)-N-[(4-methoxyphenyl)methyl]-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 42601335) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is (1R,5R,9S,13S)-N-[(4-methoxyphenyl)methyl]-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1R,5R,9S,13S)-N-[(4-methoxyphenyl)methyl]-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 42601335 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | (1R,5R,9S,13S)-N-[(4-methoxyphenyl)methyl]-5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@]2(C)CCC[C@@]3(C)C4CC[C@@]5(C)C[C@]4(CCC32)CC5=O)cc1 |
| InChI | InChI=1S/C28H39NO3/c1-25-14-10-22-26(2)12-5-13-27(3,21(26)11-15-28(22,18-25)16-23(25)30)24(31)29-17-19-6-8-20(32-4)9-7-19/h6-9,21-22H,5,10-18H2,1-4H3,(H,29,31)/t21?,22?,25-,26+,27+,28-/m0/s1 |
| InChIKey | YLHJJCIMCUBIGM-NQPOPKTLSA-N |
| XLogP | 5.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |