C28H39NO2 — CID 42601336
(1R,5R,9S,13S)-5,9,13-trimethyl-N-[(4-methylphenyl)methyl]-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide (PubChem CID 42601336) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is (1R,5R,9S,13S)-5,9,13-trimethyl-N-[(4-methylphenyl)methyl]-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide.
| Compound Name | (1R,5R,9S,13S)-5,9,13-trimethyl-N-[(4-methylphenyl)methyl]-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
|---|---|
| PubChem CID | 42601336 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (1R,5R,9S,13S)-5,9,13-trimethyl-N-[(4-methylphenyl)methyl]-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxamide |
| SMILES | Cc1ccc(CNC(=O)[C@]2(C)CCC[C@@]3(C)C4CC[C@@]5(C)C[C@]4(CCC32)CC5=O)cc1 |
| InChI | InChI=1S/C28H39NO2/c1-19-6-8-20(9-7-19)17-29-24(31)27(4)13-5-12-26(3)21(27)11-15-28-16-23(30)25(2,18-28)14-10-22(26)28/h6-9,21-22H,5,10-18H2,1-4H3,(H,29,31)/t21?,22?,25-,26+,27+,28-/m0/s1 |
| InChIKey | SCGLVFUCAHFLMI-NQPOPKTLSA-N |
| XLogP | 5.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |