C16H17NO2S — CID 42601405
7-(benzenesulfonyl)-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 42601405) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-(benzenesulfonyl)-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 42601405 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 7-(benzenesulfonyl)-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C16H17NO2S/c18-20(19,15-4-2-1-3-5-15)16-7-6-13-8-10-17-11-9-14(13)12-16/h1-7,12,17H,8-11H2 |
| InChIKey | MXLYGGPBHQMGJW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |