About 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid
3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid (PubChem CID 42601459) has the molecular formula C26H29NO2
and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid |
| PubChem CID | 42601459 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid |
| SMILES | C[C@@H](N[C@H]1CC[C@H](c2ccc(CCC(=O)O)cc2)C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H29NO2/c1-18(24-8-4-6-21-5-2-3-7-25(21)24)27-23-15-14-22(17-23)20-12-9-19(10-13-20)11-16-26(28)29/h2-10,12-13,18,22-23,27H,11,14-17H2,1H3,(H,28,29)/t18-,22+,23+/m1/s1 |
| InChIKey | WBGCUCXHNLOCLP-LEOXJPRUSA-N |
| XLogP | 5.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid?
The IUPAC name of 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid (CID 42601459) is 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid.
What is the SMILES notation for 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid?
The canonical SMILES for 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid is C[C@@H](N[C@H]1CC[C@H](c2ccc(CCC(=O)O)cc2)C1)c1cccc2ccccc12.
What is the InChIKey of 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid?
The InChIKey is WBGCUCXHNLOCLP-LEOXJPRUSA-N. The full InChI is InChI=1S/C26H29NO2/c1-18(24-8-4-6-21-5-2-3-7-25(21)24)27-23-15-14-22(17-23)20-12-9-19(10-13-20)11-16-26(28)29/h2-10,12-13,18,22-23,27H,11,14-17H2,1H3,(H,28,29)/t18-,22+,23+/m1/s1.
What are the key properties of 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid?
3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid has a molecular weight of 387.52 g/mol, XLogP of 5.84, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1S,3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]cyclopentyl]phenyl]propanoic acid is sourced from PubChem (CID 42601459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).