C18H18ClN9S — CID 42601632
1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-3-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 42601632) has the molecular formula C18H18ClN9S and a molecular weight of 427.93 g/mol. Its IUPAC name is 1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-3-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-3-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 42601632 |
| Molecular Formula | C18H18ClN9S |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1-(2-chloro-7-methylthieno[3,2-d]pyrimidin-4-yl)-3-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1csc2c(-n3nc(Nc4cnc5c(c4)CN(C)CC5)nc3N)nc(Cl)nc12 |
| InChI | InChI=1S/C18H18ClN9S/c1-9-8-29-14-13(9)23-16(19)24-15(14)28-17(20)25-18(26-28)22-11-5-10-7-27(2)4-3-12(10)21-6-11/h5-6,8H,3-4,7H2,1-2H3,(H3,20,22,25,26) |
| InChIKey | DZRIYKDWJWXKDN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |