About N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide
N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide (PubChem CID 42601979) has the molecular formula C18H26FN3O3S
and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide |
| PubChem CID | 42601979 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide |
| SMILES | CCC(C)S(=O)(=O)NCC1CCC(Nc2nc3cc(F)ccc3o2)CC1 |
| InChI | InChI=1S/C18H26FN3O3S/c1-3-12(2)26(23,24)20-11-13-4-7-15(8-5-13)21-18-22-16-10-14(19)6-9-17(16)25-18/h6,9-10,12-13,15,20H,3-5,7-8,11H2,1-2H3,(H,21,22) |
| InChIKey | QZSQYZKECBKBNU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide?
The IUPAC name of N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide (CID 42601979) is N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide.
What is the SMILES notation for N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide?
The canonical SMILES for N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide is CCC(C)S(=O)(=O)NCC1CCC(Nc2nc3cc(F)ccc3o2)CC1.
What is the InChIKey of N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide?
The InChIKey is QZSQYZKECBKBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26FN3O3S/c1-3-12(2)26(23,24)20-11-13-4-7-15(8-5-13)21-18-22-16-10-14(19)6-9-17(16)25-18/h6,9-10,12-13,15,20H,3-5,7-8,11H2,1-2H3,(H,21,22).
What are the key properties of N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide?
N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide has a molecular weight of 383.49 g/mol, XLogP of 3.66, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(5-fluoro-1,3-benzoxazol-2-yl)amino]cyclohexyl]methyl]butane-2-sulfonamide is sourced from PubChem (CID 42601979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).