C22H24FNO4 — CID 42602332
2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]benzaldehyde (PubChem CID 42602332) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]benzaldehyde.
| Compound Name | 2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]benzaldehyde |
|---|---|
| PubChem CID | 42602332 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]benzaldehyde |
| SMILES | O=Cc1ccccc1OC[C@@H](O)CN1CCC2(CC1)Cc1cc(F)ccc1O2 |
| InChI | InChI=1S/C22H24FNO4/c23-18-5-6-21-17(11-18)12-22(28-21)7-9-24(10-8-22)13-19(26)15-27-20-4-2-1-3-16(20)14-25/h1-6,11,14,19,26H,7-10,12-13,15H2/t19-/m0/s1 |
| InChIKey | NBKWYLQCOVGOIR-IBGZPJMESA-N |
| XLogP | 2.85 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|