C35H62O8 — CID 42602649
(1R,3S,7S,8E,11R,15R,19R,21S)-11-decyl-11,19-dihydroxy-15-(hydroxymethyl)-10,10-dimethyl-6,16,25,26-tetraoxatricyclo[19.3.1.13,7]hexacos-8-en-17-one (PubChem CID 42602649) has the molecular formula C35H62O8 and a molecular weight of 610.87 g/mol. Its IUPAC name is (1R,3S,7S,8E,11R,15R,19R,21S)-11-decyl-11,19-dihydroxy-15-(hydroxymethyl)-10,10-dimethyl-6,16,25,26-tetraoxatricyclo[19.3.1.13,7]hexacos-8-en-17-one.
| Compound Name | (1R,3S,7S,8E,11R,15R,19R,21S)-11-decyl-11,19-dihydroxy-15-(hydroxymethyl)-10,10-dimethyl-6,16,25,26-tetraoxatricyclo[19.3.1.13,7]hexacos-8-en-17-one |
|---|---|
| PubChem CID | 42602649 |
| Molecular Formula | C35H62O8 |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.44 |
| IUPAC Name | (1R,3S,7S,8E,11R,15R,19R,21S)-11-decyl-11,19-dihydroxy-15-(hydroxymethyl)-10,10-dimethyl-6,16,25,26-tetraoxatricyclo[19.3.1.13,7]hexacos-8-en-17-one |
| SMILES | CCCCCCCCCC[C@@]1(O)CCC[C@H](CO)OC(=O)C[C@H](O)C[C@@H]2CCC[C@H](C[C@@H]3CCO[C@H](/C=C/C1(C)C)O3)O2 |
| InChI | InChI=1S/C35H62O8/c1-4-5-6-7-8-9-10-11-19-35(39)20-13-16-31(26-36)42-32(38)24-27(37)23-28-14-12-15-29(41-28)25-30-18-22-40-33(43-30)17-21-34(35,2)3/h17,21,27-31,33,36-37,39H,4-16,18-20,22-26H2,1-3H3/b21-17+/t27-,28+,29-,30+,31-,33+,35-/m1/s1 |
| InChIKey | AADVIVJUOSDCHI-ZPJDWXHMSA-N |
| XLogP | 6.52 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|