C30H33N3O6 — CID 42602893
5-hydroxy-2,2-dimethyl-10-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-6-propanoylpyrano[2,3-f]chromen-8-one (PubChem CID 42602893) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is 5-hydroxy-2,2-dimethyl-10-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-6-propanoylpyrano[2,3-f]chromen-8-one.
| Compound Name | 5-hydroxy-2,2-dimethyl-10-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-6-propanoylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 42602893 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 5-hydroxy-2,2-dimethyl-10-[4-oxo-4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-6-propanoylpyrano[2,3-f]chromen-8-one |
| SMILES | CCC(=O)c1c(O)c2c(c3c(CCCC(=O)N4CCN(c5ccccn5)CC4)cc(=O)oc13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C30H33N3O6/c1-4-21(34)26-27(37)20-11-12-30(2,3)39-28(20)25-19(18-24(36)38-29(25)26)8-7-10-23(35)33-16-14-32(15-17-33)22-9-5-6-13-31-22/h5-6,9,11-13,18,37H,4,7-8,10,14-17H2,1-3H3 |
| InChIKey | QRWSWGSHMOFYPF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|