C20H30N4S2 — CID 42602908
N,N'-diethyl-N,N'-bis(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)ethane-1,2-diamine (PubChem CID 42602908) has the molecular formula C20H30N4S2 and a molecular weight of 390.62 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N,N'-bis(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 42602908 |
| Molecular Formula | C20H30N4S2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N,N'-diethyl-N,N'-bis(4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)ethane-1,2-diamine |
| SMILES | CCN(CCN(CC)C1CCc2ncsc2C1)C1CCc2ncsc2C1 |
| InChI | InChI=1S/C20H30N4S2/c1-3-23(15-5-7-17-19(11-15)25-13-21-17)9-10-24(4-2)16-6-8-18-20(12-16)26-14-22-18/h13-16H,3-12H2,1-2H3 |
| InChIKey | MTKLADMEMSMOTF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |